Products 106269-68-5

CAS 106269-68-5 is the registry number for Ethyl 2,3-dimethyl-1h-indole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,3-dimethyl-1H-indole-4-carboxylate (CAS 106269-68-5) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: ethyl 2,3-dimethyl-1H-indole-4-carboxylate. InChIKey: VVRLKZYNHIHXGT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC nameethyl 2,3-dimethyl-1H-indole-4-carboxylate
InChIKeyVVRLKZYNHIHXGT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2C(=C(NC2=CC=C1)C)C

Computed by PubChem (NCBI)