CAS 106269-68-5 is the registry number for Ethyl 2,3-dimethyl-1h-indole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2,3-dimethyl-1H-indole-4-carboxylate (CAS 106269-68-5) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: ethyl 2,3-dimethyl-1H-indole-4-carboxylate. InChIKey: VVRLKZYNHIHXGT-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | ethyl 2,3-dimethyl-1H-indole-4-carboxylate |
| InChIKey | VVRLKZYNHIHXGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=C(NC2=CC=C1)C)C |
Computed by PubChem (NCBI)