Products 1063989-43-4

CAS 1063989-43-4 is the registry number for 1-tert-Butyl 2-methyl 2,3-dihydro-1h-pyrrole-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 2,3-dihydropyrrole-1,2-dicarboxylate (CAS 1063989-43-4) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: WGCPPYJWSDCBNC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO4
Molecular weight227.26 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 2,3-dihydropyrrole-1,2-dicarboxylate
InChIKeyWGCPPYJWSDCBNC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=CCC1C(=O)OC

Computed by PubChem (NCBI)