Products 1260617-47-7
CAS 1260617-47-7 appears in our catalog under these names: 1-(tert-Butyl) 2-methyl (R)-2,3-dihydro-1H-pyrrole-1,2-dicarboxylate, 93%, 93%, O1-tert-butyl O2-methyl (2R)-2,3-dihydropyrrole-1,2-dicarboxylate, 93%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
1-O-tert-butyl 2-O-methyl (2R)-2,3-dihydropyrrole-1,2-dicarboxylate (CAS 1260617-47-7) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: WGCPPYJWSDCBNC-MRVPVSSYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-2,3-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | WGCPPYJWSDCBNC-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)