CAS 1065074-18-1 is the registry number for 4-(3-Chloro-4-methylphenyl)-1H-1,2,4-triazol-5(4H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazol-5-one (CAS 1065074-18-1) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazol-5-one. InChIKey: FFUXAHFLJASLJH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | FFUXAHFLJASLJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=NNC2=O)Cl |
Computed by PubChem (NCBI)