Products 133902-66-6
CAS 133902-66-6 appears in our catalog under these names: [1-(4-Chlorophenyl)-1h-1,2,3-triazol-4-yl]methanol, 95%, (1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl)methanol, [1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 50mg.
[1-(4-chlorophenyl)triazol-4-yl]methanol (CAS 133902-66-6) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: [1-(4-chlorophenyl)triazol-4-yl]methanol. InChIKey: CAHIFLPAMJOAGI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | [1-(4-chlorophenyl)triazol-4-yl]methanol |
| InChIKey | CAHIFLPAMJOAGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CO)Cl |
Computed by PubChem (NCBI)