CAS 20948-67-8 is the registry number for 5-Chloro-1h-indole-2-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
5-chloro-1H-indole-2-carbohydrazide (CAS 20948-67-8) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 5-chloro-1H-indole-2-carbohydrazide. InChIKey: PWHHLZAKLPOCGN-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 5-chloro-1H-indole-2-carbohydrazide |
| InChIKey | PWHHLZAKLPOCGN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=C(N2)C(=O)NN |
Computed by PubChem (NCBI)