CAS 1126635-72-0 appears in our catalog under these names: [1-(2-Chlorophenyl)-1h-1,2,3-triazol-4-yl]methanol, 95%, (1-(2-Chlorophenyl)-1H-1,2,3-triazol-4-yl)methanol, 95%, (1-(2-Chlorophenyl)-1H-1,2,3-triazol-4-yl)methanol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
[1-(2-chlorophenyl)triazol-4-yl]methanol (CAS 1126635-72-0) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: [1-(2-chlorophenyl)triazol-4-yl]methanol. InChIKey: IWUAROCRGSEOMO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | [1-(2-chlorophenyl)triazol-4-yl]methanol |
| InChIKey | IWUAROCRGSEOMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)CO)Cl |
Computed by PubChem (NCBI)