CAS 1065074-63-6 is the registry number for Methyl 2-amino-4-(3-bromophenyl)thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 2-amino-4-(3-bromophenyl)-1,3-thiazole-5-carboxylate (CAS 1065074-63-6) is a chemical compound with the molecular formula C11H9BrN2O2S and a molecular weight of 313.17 g/mol. IUPAC name: methyl 2-amino-4-(3-bromophenyl)-1,3-thiazole-5-carboxylate. InChIKey: NXKPBFWGNXNBSI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2S |
|---|---|
| Molecular weight | 313.17 g/mol |
| IUPAC name | methyl 2-amino-4-(3-bromophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | NXKPBFWGNXNBSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(S1)N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)