CAS 797008-44-7 is the registry number for 2-Bromo-5-methoxy-N-(thiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-methoxy-N-(1,3-thiazol-2-yl)benzamide (CAS 797008-44-7) is a chemical compound with the molecular formula C11H9BrN2O2S and a molecular weight of 313.17 g/mol. IUPAC name: 2-bromo-5-methoxy-N-(1,3-thiazol-2-yl)benzamide. InChIKey: RSMRBZNUOOELBS-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2S |
|---|---|
| Molecular weight | 313.17 g/mol |
| IUPAC name | 2-bromo-5-methoxy-N-(1,3-thiazol-2-yl)benzamide |
| InChIKey | RSMRBZNUOOELBS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)NC2=NC=CS2 |
Computed by PubChem (NCBI)