CAS 877468-12-7 is the registry number for N-(5-Bromothiazol-2-yl)-2-hydroxy-3-methylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-bromo-1,3-thiazol-2-yl)-2-hydroxy-3-methylbenzamide (CAS 877468-12-7) is a chemical compound with the molecular formula C11H9BrN2O2S and a molecular weight of 313.17 g/mol. IUPAC name: N-(5-bromo-1,3-thiazol-2-yl)-2-hydroxy-3-methylbenzamide. InChIKey: ZNEBVPDLAHSKDD-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2S |
|---|---|
| Molecular weight | 313.17 g/mol |
| IUPAC name | N-(5-bromo-1,3-thiazol-2-yl)-2-hydroxy-3-methylbenzamide |
| InChIKey | ZNEBVPDLAHSKDD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)NC2=NC=C(S2)Br)O |
Computed by PubChem (NCBI)