CAS 1072944-52-5 is the registry number for Methyl 2–amino–5–(4–bromophenyl)thiazole–4–carboxylate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Methyl 2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 1072944-52-5) is a chemical compound with the molecular formula C11H9BrN2O2S and a molecular weight of 313.17 g/mol. IUPAC name: methyl 2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: BJJRSGFNTBHACP-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2S |
|---|---|
| Molecular weight | 313.17 g/mol |
| IUPAC name | methyl 2-amino-5-(4-bromophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | BJJRSGFNTBHACP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC(=N1)N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)