CAS 1065221-20-6 is the registry number for Naphtho[2,1-b]furan-1-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzo[e][1]benzofuran-1-carbaldehyde (CAS 1065221-20-6) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: benzo[e][1]benzofuran-1-carbaldehyde. InChIKey: ILXXIRRRLVDDJH-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | benzo[e][1]benzofuran-1-carbaldehyde |
| InChIKey | ILXXIRRRLVDDJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=CO3)C=O |
Computed by PubChem (NCBI)