CAS 4843-43-0 appears in our catalog under these names: 3-(2-Naphthyl)prop-2-ynoic acid, 95%, 3-(Naphthalen-2-yl)propiolic acid 95+%, 3-(Naphthalen-2-yl)propiolic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
3-naphthalen-2-ylprop-2-ynoic acid (CAS 4843-43-0) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: 3-naphthalen-2-ylprop-2-ynoic acid. InChIKey: XWMRRMQMFPBLTP-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-naphthalen-2-ylprop-2-ynoic acid |
| InChIKey | XWMRRMQMFPBLTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C#CC(=O)O |
Computed by PubChem (NCBI)