CAS 6949-73-1 appears in our catalog under these names: 2-Hydroxy-9-fluorenone, 95%, 2–Hydroxy–9–fluorenone, 2-Hydroxy-9-fluorenone, >90.0%(HPLC)(T), 2-Hydroxy-9H-fluoren-9-one 96%, 2-Hydroxy-9H-Fluoren-9-One, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg.
2-hydroxyfluoren-9-one (CAS 6949-73-1) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: 2-hydroxyfluoren-9-one. InChIKey: GXUBPHMYNSICJC-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-hydroxyfluoren-9-one |
| InChIKey | GXUBPHMYNSICJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)