CAS 96706-46-6 appears in our catalog under these names: Dibenzo(b,d)furan–4–carbaldehyde, Dibenzofuran-4-carboxaldehyde, >98.0%(GC), Dibenzo[b,d]furan-4-carbaldehyde 98%, dibenzo[b,d]furan-4-carbaldehyde, 98%, 98%, dibenzo[b,d]furan-4-carbaldehyde, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 250mg, 10g.
Dibenzofuran-4-carbaldehyde (CAS 96706-46-6) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: dibenzofuran-4-carbaldehyde. InChIKey: GQYTWBPRZFRASB-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | dibenzofuran-4-carbaldehyde |
| InChIKey | GQYTWBPRZFRASB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC(=C3O2)C=O |
Computed by PubChem (NCBI)