Products 1067880-31-2
CAS 1067880-31-2 is the registry number for isoCA-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenol (CAS 1067880-31-2) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: 2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenol. InChIKey: CNGKIRSNRQSORA-UHFFFAOYSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| InChIKey | CNGKIRSNRQSORA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=C)C2=CC(=C(C(=C2)OC)OC)OC)O |
Computed by PubChem (NCBI)