Products 85022-66-8
CAS 85022-66-8 appears in our catalog under these names: shikonofuran A, Shikonofuran A, Shikonofuran A, 98.00%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 1mg, Get quote.
[1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] acetate (CAS 85022-66-8) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: [1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] acetate. InChIKey: IMZVJDUASUPZQK-UHFFFAOYSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | [1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] acetate |
| InChIKey | IMZVJDUASUPZQK-UHFFFAOYSA-N |
| SMILES | CC(=CCC(C1=COC(=C1)C2=C(C=CC(=C2)O)O)OC(=O)C)C |
Computed by PubChem (NCBI)