CAS 1293913-16-2 is the registry number for (2R,3R)-4-Hydroxy-2,3-bis(phenylmethoxy)-butanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butanoic acid (CAS 1293913-16-2) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: (2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butanoic acid. InChIKey: BDFMIPYELGLIOP-IAGOWNOFSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | (2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butanoic acid |
| InChIKey | BDFMIPYELGLIOP-IAGOWNOFSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H](CO)[C@H](C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)