Products 440094-38-2
CAS 440094-38-2 is the registry number for (R)-o-Isobutyroyllomatin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
[(9R)-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-9-yl] 2-methylpropanoate (CAS 440094-38-2) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: [(9R)-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-9-yl] 2-methylpropanoate. InChIKey: PKHNHXIOSSYBJU-CQSZACIVSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | [(9R)-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-9-yl] 2-methylpropanoate |
| InChIKey | PKHNHXIOSSYBJU-CQSZACIVSA-N |
| SMILES | CC(C)C(=O)O[C@@H]1CC2=C(C=CC3=C2OC(=O)C=C3)OC1(C)C |
Computed by PubChem (NCBI)
Synonyms:
(R)-O-isobutyroyllomatin, orb1680225