Products 1067914-57-1

CAS 1067914-57-1 is the registry number for 8-Bromo-5-fluoroquinoline-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

8-bromo-5-fluoroquinoline-2-carboxylic acid (CAS 1067914-57-1) is a chemical compound with the molecular formula C10H5BrFNO2 and a molecular weight of 270.05 g/mol. IUPAC name: 8-bromo-5-fluoroquinoline-2-carboxylic acid. InChIKey: NWPHMULLPITJJY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrFNO2
Molecular weight270.05 g/mol
IUPAC name8-bromo-5-fluoroquinoline-2-carboxylic acid
InChIKeyNWPHMULLPITJJY-UHFFFAOYSA-N
SMILESC1=CC(=NC2=C(C=CC(=C21)F)Br)C(=O)O

Computed by PubChem (NCBI)