CAS 1067914-57-1 is the registry number for 8-Bromo-5-fluoroquinoline-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
8-bromo-5-fluoroquinoline-2-carboxylic acid (CAS 1067914-57-1) is a chemical compound with the molecular formula C10H5BrFNO2 and a molecular weight of 270.05 g/mol. IUPAC name: 8-bromo-5-fluoroquinoline-2-carboxylic acid. InChIKey: NWPHMULLPITJJY-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO2 |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 8-bromo-5-fluoroquinoline-2-carboxylic acid |
| InChIKey | NWPHMULLPITJJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C=CC(=C21)F)Br)C(=O)O |
Computed by PubChem (NCBI)