CAS 279686-72-5 appears in our catalog under these names: 3-Bromo-1-(4-fluorophenyl)-1h-pyrrole-2,5-dione, 95%, 3-Bromo-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-bromo-1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 279686-72-5) is a chemical compound with the molecular formula C10H5BrFNO2 and a molecular weight of 270.05 g/mol. IUPAC name: 3-bromo-1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: MIOWRNLNVURVCC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO2 |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 3-bromo-1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | MIOWRNLNVURVCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=C(C2=O)Br)F |
Computed by PubChem (NCBI)