Products 834884-22-9
CAS 834884-22-9 is the registry number for 8-Bromo-3-fluoroquinoline-4-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
8-bromo-3-fluoroquinoline-4-carboxylic acid (CAS 834884-22-9) is a chemical compound with the molecular formula C10H5BrFNO2 and a molecular weight of 270.05 g/mol. IUPAC name: 8-bromo-3-fluoroquinoline-4-carboxylic acid. InChIKey: JEJPYTZZQULSTC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO2 |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 8-bromo-3-fluoroquinoline-4-carboxylic acid |
| InChIKey | JEJPYTZZQULSTC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)