Products 1420790-57-3
CAS 1420790-57-3 appears in our catalog under these names: 5-Bromo-6-fluoroquinoline-2-carboxylic acid, 97%, 97%, 5-BROMO-6-FLUOROQUINOLINE-2-CARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-bromo-6-fluoroquinoline-2-carboxylic acid (CAS 1420790-57-3) is a chemical compound with the molecular formula C10H5BrFNO2 and a molecular weight of 270.05 g/mol. IUPAC name: 5-bromo-6-fluoroquinoline-2-carboxylic acid. InChIKey: ALSYIUBWVDLGQT-UHFFFAOYSA-N.
| Molecular formula | C10H5BrFNO2 |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 5-bromo-6-fluoroquinoline-2-carboxylic acid |
| InChIKey | ALSYIUBWVDLGQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=C(C=C2)F)Br)C(=O)O |
Computed by PubChem (NCBI)