Products 1068515-53-6
CAS 1068515-53-6 appears in our catalog under these names: KDM4-IN-3, KDM4-IN-3, 99.36%, KDM4-IN-3, 99%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 2mg, 100 mg, 10 mg, 10mM/1mL, 5 mg, 50 mg, 25 mg, 5mg.
2-(1H-benzimidazol-2-yl)-5-methyl-4-phenyl-1H-pyrazol-3-one (CAS 1068515-53-6) is a chemical compound with the molecular formula C17H14N4O and a molecular weight of 290.32 g/mol. IUPAC name: 2-(1H-benzimidazol-2-yl)-5-methyl-4-phenyl-1H-pyrazol-3-one. InChIKey: YNQAUNMBAVKOIN-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O |
|---|---|
| Molecular weight | 290.32 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-yl)-5-methyl-4-phenyl-1H-pyrazol-3-one |
| InChIKey | YNQAUNMBAVKOIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=NC3=CC=CC=C3N2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)