Products 569655-94-3
CAS 569655-94-3 appears in our catalog under these names: 5-(1H-Indol-3-yl)-6-phenyl-4,5-dihydro-1,2,4-triazin-3(2H)-one, 97%, 5-(1H-Indol-3-yl)-6-phenyl-4,5-dihydro-1,2,4-triazin-3(2H)-one, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
5-(1H-indol-3-yl)-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one (CAS 569655-94-3) is a chemical compound with the molecular formula C17H14N4O and a molecular weight of 290.32 g/mol. IUPAC name: 5-(1H-indol-3-yl)-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one. InChIKey: ROKSSOLVLOHHMN-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O |
|---|---|
| Molecular weight | 290.32 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one |
| InChIKey | ROKSSOLVLOHHMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=O)NC2C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)