CAS 785809-41-8 is the registry number for 2-[(1H-1,3-benzodiazol-1-yl)methyl]-7-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg.
2-(benzimidazol-1-ylmethyl)-7-methylpyrido[1,2-a]pyrimidin-4-one (CAS 785809-41-8) is a chemical compound with the molecular formula C17H14N4O and a molecular weight of 290.32 g/mol. IUPAC name: 2-(benzimidazol-1-ylmethyl)-7-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: ZISNXXHPWPDGCE-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O |
|---|---|
| Molecular weight | 290.32 g/mol |
| IUPAC name | 2-(benzimidazol-1-ylmethyl)-7-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | ZISNXXHPWPDGCE-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=CC2=O)CN3C=NC4=CC=CC=C43)C=C1 |
Computed by PubChem (NCBI)