Products 49676-35-9
CAS 49676-35-9 is the registry number for OX01914. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,6-diphenylpyrimidine-2-carbohydrazide (CAS 49676-35-9) is a chemical compound with the molecular formula C17H14N4O and a molecular weight of 290.32 g/mol. IUPAC name: 4,6-diphenylpyrimidine-2-carbohydrazide. InChIKey: WQLVMRVQMYSEQZ-UHFFFAOYSA-N.
| Molecular formula | C17H14N4O |
|---|---|
| Molecular weight | 290.32 g/mol |
| IUPAC name | 4,6-diphenylpyrimidine-2-carbohydrazide |
| InChIKey | WQLVMRVQMYSEQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C(=O)NN)C3=CC=CC=C3 |
Computed by PubChem (NCBI)