CAS 1068604-45-4 appears in our catalog under these names: 3-Bromo-5-(4-methoxy-benzyloxy)-benzonitrile, 98%, 3-Bromo-5-((4-methoxybenzyl)oxy)benzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
3-bromo-5-[(4-methoxyphenyl)methoxy]benzonitrile (CAS 1068604-45-4) is a chemical compound with the molecular formula C15H12BrNO2 and a molecular weight of 318.16 g/mol. IUPAC name: 3-bromo-5-[(4-methoxyphenyl)methoxy]benzonitrile. InChIKey: QMBBGCLINHISLC-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2 |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | 3-bromo-5-[(4-methoxyphenyl)methoxy]benzonitrile |
| InChIKey | QMBBGCLINHISLC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC(=CC(=C2)C#N)Br |
Computed by PubChem (NCBI)