Products 1551538-49-8
CAS 1551538-49-8 is the registry number for 5-Bromo-2-(4-methoxy-benzyloxy)-benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
5-bromo-2-[(4-methoxyphenyl)methoxy]benzonitrile (CAS 1551538-49-8) is a chemical compound with the molecular formula C15H12BrNO2 and a molecular weight of 318.16 g/mol. IUPAC name: 5-bromo-2-[(4-methoxyphenyl)methoxy]benzonitrile. InChIKey: TVBDISIKGUJYFT-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2 |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | 5-bromo-2-[(4-methoxyphenyl)methoxy]benzonitrile |
| InChIKey | TVBDISIKGUJYFT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)