CAS 150000-18-3 appears in our catalog under these names: 4-(3-Bromophenyl)-4-azatricyclo(5.2.1.0,2,6)dec-8-ene-3,5-dione, 98%, 4-(3-Bromophenyl)-4-azatricyclo(5.2.1.0,2,6)dec-8-ene-3,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 150000-18-3) is a chemical compound with the molecular formula C15H12BrNO2 and a molecular weight of 318.16 g/mol. IUPAC name: 4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: UCSQPCJPUUPAPF-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2 |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | 4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | UCSQPCJPUUPAPF-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)