Products 1206912-98-2

CAS 1206912-98-2 is the registry number for N-(2-Bromophenyl)-N-methyl-α-oxobenzeneacetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

N-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide (CAS 1206912-98-2) is a chemical compound with the molecular formula C15H12BrNO2 and a molecular weight of 318.16 g/mol. IUPAC name: N-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide. InChIKey: VJNOGFOOOSXXEK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12BrNO2
Molecular weight318.16 g/mol
IUPAC nameN-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide
InChIKeyVJNOGFOOOSXXEK-UHFFFAOYSA-N
SMILESCN(C1=CC=CC=C1Br)C(=O)C(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)