Products 1206912-98-2
CAS 1206912-98-2 is the registry number for N-(2-Bromophenyl)-N-methyl-α-oxobenzeneacetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide (CAS 1206912-98-2) is a chemical compound with the molecular formula C15H12BrNO2 and a molecular weight of 318.16 g/mol. IUPAC name: N-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide. InChIKey: VJNOGFOOOSXXEK-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2 |
|---|---|
| Molecular weight | 318.16 g/mol |
| IUPAC name | N-(2-bromophenyl)-N-methyl-2-oxo-2-phenylacetamide |
| InChIKey | VJNOGFOOOSXXEK-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1Br)C(=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)