CAS 106877-40-1 is the registry number for 5-Methoxy-2-(trifluoromethyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
5-methoxy-2-(trifluoromethyl)phenol (CAS 106877-40-1) is a chemical compound with the molecular formula C8H7F3O2 and a molecular weight of 192.13 g/mol. IUPAC name: 5-methoxy-2-(trifluoromethyl)phenol. InChIKey: RRHXUHOVPBIAOU-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 5-methoxy-2-(trifluoromethyl)phenol |
| InChIKey | RRHXUHOVPBIAOU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)