CAS 106910-76-3 appears in our catalog under these names: 2–(Benzylamino)–3–hydroxypropanoic acid, 2-(Benzylamino)-3-hydroxypropanoic acid, 95%, 2-(Benzylamino)-3-hydroxypropanoic acid, 98%, 2-(Benzylamino)-3-hydroxypropanoic acid, 98%, 98%, Bzl-DL-Ser-OH 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg.
2-(benzylamino)-3-hydroxypropanoic acid (CAS 106910-76-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-(benzylamino)-3-hydroxypropanoic acid. InChIKey: CTSBUHPWELFRGB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-(benzylamino)-3-hydroxypropanoic acid |
| InChIKey | CTSBUHPWELFRGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(CO)C(=O)O |
Computed by PubChem (NCBI)