Products 17136-45-7
CAS 17136-45-7 appears in our catalog under these names: Bzl–Ser–OH, Bzl-Ser-OH 98%, L-N-Benzylserine, 98%, 98%, Benzyl-L-serine, 99.98%, (S)-N-Benzylserine, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 10g, 25g, 250 mg, 1 g.
(2S)-2-(benzylamino)-3-hydroxypropanoic acid (CAS 17136-45-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2S)-2-(benzylamino)-3-hydroxypropanoic acid. InChIKey: CTSBUHPWELFRGB-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-3-hydroxypropanoic acid |
| InChIKey | CTSBUHPWELFRGB-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)