CAS 106910-77-4 appears in our catalog under these names: (R)-2-(Benzylamino)-3-hydroxypropanoic acid, Bzl-D-Ser-OH 97%, (R)-2-(Benzylamino)-3-hydroxypropanoic acid, 97%, 97%, (R)-2-(Benzylamino)-3-hydroxypropanoic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 100mg, 250mg, 1g, 5g, 25g.
(2R)-2-(benzylamino)-3-hydroxypropanoic acid (CAS 106910-77-4) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2R)-2-(benzylamino)-3-hydroxypropanoic acid. InChIKey: CTSBUHPWELFRGB-SECBINFHSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2R)-2-(benzylamino)-3-hydroxypropanoic acid |
| InChIKey | CTSBUHPWELFRGB-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@H](CO)C(=O)O |
Computed by PubChem (NCBI)