Products 1070237-84-1
CAS 1070237-84-1 is the registry number for (E)-Ethyl 2-methyl-3-nitroacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (E)-2-methyl-3-nitroprop-2-enoate (CAS 1070237-84-1) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: ethyl (E)-2-methyl-3-nitroprop-2-enoate. InChIKey: VWNOIOYJZLAKBX-SNAWJCMRSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | ethyl (E)-2-methyl-3-nitroprop-2-enoate |
| InChIKey | VWNOIOYJZLAKBX-SNAWJCMRSA-N |
| SMILES | CCOC(=O)/C(=C/[N+](=O)[O-])/C |
Computed by PubChem (NCBI)