CAS 1808068-88-3 is the registry number for (3R,4R)-Pyrrolidine-3,4-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-pyrrolidine-3,4-dicarboxylic acid (CAS 1808068-88-3) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: (3R,4R)-pyrrolidine-3,4-dicarboxylic acid. InChIKey: KMHDKGFRYVKQNW-IMJSIDKUSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | (3R,4R)-pyrrolidine-3,4-dicarboxylic acid |
| InChIKey | KMHDKGFRYVKQNW-IMJSIDKUSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)