Products 2171619-12-6

CAS 2171619-12-6 is the registry number for 2-Formamido-2-(oxetan-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-formamido-2-(oxetan-3-yl)acetic acid (CAS 2171619-12-6) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: 2-formamido-2-(oxetan-3-yl)acetic acid. InChIKey: DJILURHLRAXXPV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9NO4
Molecular weight159.14 g/mol
IUPAC name2-formamido-2-(oxetan-3-yl)acetic acid
InChIKeyDJILURHLRAXXPV-UHFFFAOYSA-N
SMILESC1C(CO1)C(C(=O)O)NC=O

Computed by PubChem (NCBI)