CAS 155321-75-8 is the registry number for (2R,3S)-3-Methoxy-4-oxoazetidin-2-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S)-3-methoxy-4-oxoazetidin-2-yl] acetate (CAS 155321-75-8) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: [(2R,3S)-3-methoxy-4-oxoazetidin-2-yl] acetate. InChIKey: LBWMIKVFANMWFL-INEUFUBQSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | [(2R,3S)-3-methoxy-4-oxoazetidin-2-yl] acetate |
| InChIKey | LBWMIKVFANMWFL-INEUFUBQSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](C(=O)N1)OC |
Computed by PubChem (NCBI)