CAS 107057-96-5 is the registry number for 5-Hydroxy-3,4,7-trimethyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-hydroxy-3,4,7-trimethylchromen-2-one (CAS 107057-96-5) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 5-hydroxy-3,4,7-trimethylchromen-2-one. InChIKey: HMTPJAGDJGBKEB-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 5-hydroxy-3,4,7-trimethylchromen-2-one |
| InChIKey | HMTPJAGDJGBKEB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C(C(=O)OC2=C1)C)C)O |
Computed by PubChem (NCBI)