CAS 1070879-83-2 appears in our catalog under these names: 6–Chloro–8–methyl–2–phenyl–4–quinolinol, 6-Chloro-8-methyl-2-phenyl-4-quinolinol, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg.
6-chloro-8-methyl-2-phenyl-1H-quinolin-4-one (CAS 1070879-83-2) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 6-chloro-8-methyl-2-phenyl-1H-quinolin-4-one. InChIKey: PDUMMKQLAPHXRO-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 6-chloro-8-methyl-2-phenyl-1H-quinolin-4-one |
| InChIKey | PDUMMKQLAPHXRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=CC2=O)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)