CAS 107100-41-4 is the registry number for 8,9,10-Trimethoxy Urolithin M6. Offered by: TRC. Available pack sizes: 100mg.
3-hydroxy-8,9,10-trimethoxybenzo[c]chromen-6-one (CAS 107100-41-4) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 3-hydroxy-8,9,10-trimethoxybenzo[c]chromen-6-one. InChIKey: GGDCQKUCSVTTGC-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 3-hydroxy-8,9,10-trimethoxybenzo[c]chromen-6-one |
| InChIKey | GGDCQKUCSVTTGC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C3=C(C=C(C=C3)O)OC(=O)C2=C1)OC)OC |
Computed by PubChem (NCBI)