CAS 1071024-65-1 is the registry number for 3-Methyl-biphenyl-4-carboxaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
2-methyl-4-phenylbenzaldehyde (CAS 1071024-65-1) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 2-methyl-4-phenylbenzaldehyde. InChIKey: LQTGMJXOYPYLRK-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 2-methyl-4-phenylbenzaldehyde |
| InChIKey | LQTGMJXOYPYLRK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)