CAS 1071296-64-4 appears in our catalog under these names: 6-Chloro-2-(methylthio)-1,3-benzoxazole, 95%, 6-Chloro-2-(methylthio)benzo(d)oxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-chloro-2-methylsulfanyl-1,3-benzoxazole (CAS 1071296-64-4) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: 6-chloro-2-methylsulfanyl-1,3-benzoxazole. InChIKey: URXIJEWVHCFAHG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 6-chloro-2-methylsulfanyl-1,3-benzoxazole |
| InChIKey | URXIJEWVHCFAHG-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(O1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)