CAS 74695-46-8 appears in our catalog under these names: 7-Chloro-5-methoxythieno[3,2-b]pyridine, 95%, 7–Chloro–5–methoxythieno(3,2–b)pyridine, 7-Chloro-5-methoxythieno(3,2-b)pyridine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
7-chloro-5-methoxythieno[3,2-b]pyridine (CAS 74695-46-8) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: 7-chloro-5-methoxythieno[3,2-b]pyridine. InChIKey: DYIGNOAYBDOTRR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 7-chloro-5-methoxythieno[3,2-b]pyridine |
| InChIKey | DYIGNOAYBDOTRR-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C(=C1)Cl)SC=C2 |
Computed by PubChem (NCBI)