CAS 5333-05-1 is the registry number for 7-Chloro-2h-1,4-benzothiazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-chloro-4H-1,4-benzothiazin-3-one (CAS 5333-05-1) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: 7-chloro-4H-1,4-benzothiazin-3-one. InChIKey: JNPOLSNJHCFNCG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 7-chloro-4H-1,4-benzothiazin-3-one |
| InChIKey | JNPOLSNJHCFNCG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)