CAS 6376-70-1 is the registry number for 2H-1,4-Benzothiazin-3(4H)-one, 6-chloro-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4H-1,4-benzothiazin-3-one (CAS 6376-70-1) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: 6-chloro-4H-1,4-benzothiazin-3-one. InChIKey: CUAYHCBWNOSTBU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 6-chloro-4H-1,4-benzothiazin-3-one |
| InChIKey | CUAYHCBWNOSTBU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)