Products 1071389-07-5

CAS 1071389-07-5 is the registry number for 4-((4-(Methylcarbamoyl)phenyl)amino)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[4-(methylcarbamoyl)anilino]-4-oxobutanoic acid (CAS 1071389-07-5) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 4-[4-(methylcarbamoyl)anilino]-4-oxobutanoic acid. InChIKey: WKVIORQZMQSFOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O4
Molecular weight250.25 g/mol
IUPAC name4-[4-(methylcarbamoyl)anilino]-4-oxobutanoic acid
InChIKeyWKVIORQZMQSFOQ-UHFFFAOYSA-N
SMILESCNC(=O)C1=CC=C(C=C1)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)