CAS 1071522-01-4 is the registry number for Methyl (2R,3R)-3-aminobicyclo[2.2.2]octane-2-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,3R)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride (CAS 1071522-01-4) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: methyl (2R,3R)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride. InChIKey: WMXDQFWQOGJYEQ-YBHJBBPCSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | methyl (2R,3R)-3-aminobicyclo[2.2.2]octane-2-carboxylate;hydrochloride |
| InChIKey | WMXDQFWQOGJYEQ-YBHJBBPCSA-N |
| SMILES | COC(=O)[C@H]1[C@@H](C2CCC1CC2)N.Cl |
Computed by PubChem (NCBI)