Products 1071866-13-1

CAS 1071866-13-1 is the registry number for 2-Bromo-4,6-difluoro-3'-methyl-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-bromo-3,5-difluoro-2-(3-methylphenyl)benzene (CAS 1071866-13-1) is a chemical compound with the molecular formula C13H9BrF2 and a molecular weight of 283.11 g/mol. IUPAC name: 1-bromo-3,5-difluoro-2-(3-methylphenyl)benzene. InChIKey: KMEYBBKNCOXFQN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrF2
Molecular weight283.11 g/mol
IUPAC name1-bromo-3,5-difluoro-2-(3-methylphenyl)benzene
InChIKeyKMEYBBKNCOXFQN-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=C(C=C(C=C2Br)F)F

Computed by PubChem (NCBI)